[2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate

C20H22O7 — CID 2501210

IUPAC[2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate
SMILESCCOc1ccc(C(=O)OCC(=O)c2ccc(OC)cc2OC)cc1OC
InChIInChI=1S/C20H22O7/c1-5-26-17-9-6-13(10-19(17)25-4)20(22)27-12-16(21)15-8-7-14(23-2)11-18(15)24-3/h6-11H,5,12H2,1-4H3
InChIKeyLFWRICMFAGUZDQ-UHFFFAOYSA-N
MW374.39 g/mol
LogP3.15
Rot. Bonds9

About [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate

[2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate (PubChem CID 2501210) has the molecular formula C20H22O7 and a molecular weight of 374.39 g/mol. Its IUPAC name is [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate.

Molecular Properties

Compound Name[2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate
PubChem CID2501210
Molecular FormulaC20H22O7
Molecular Weight374.39 g/mol
Exact Mass374.14
IUPAC Name[2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate
SMILESCCOc1ccc(C(=O)OCC(=O)c2ccc(OC)cc2OC)cc1OC
InChIInChI=1S/C20H22O7/c1-5-26-17-9-6-13(10-19(17)25-4)20(22)27-12-16(21)15-8-7-14(23-2)11-18(15)24-3/h6-11H,5,12H2,1-4H3
InChIKeyLFWRICMFAGUZDQ-UHFFFAOYSA-N
XLogP3.15
TPSA80.29 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds9
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500374.39
LogP ≤ 53.15
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Analyze [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate?
The IUPAC name of [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate (CID 2501210) is [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate.
What is the SMILES notation for [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate?
The canonical SMILES for [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate is CCOc1ccc(C(=O)OCC(=O)c2ccc(OC)cc2OC)cc1OC.
What is the InChIKey of [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate?
The InChIKey is LFWRICMFAGUZDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22O7/c1-5-26-17-9-6-13(10-19(17)25-4)20(22)27-12-16(21)15-8-7-14(23-2)11-18(15)24-3/h6-11H,5,12H2,1-4H3.
What are the key properties of [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate?
[2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate has a molecular weight of 374.39 g/mol, XLogP of 3.15, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate is sourced from PubChem (CID 2501210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).