C20H22O7 — CID 2501210
[2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate (PubChem CID 2501210) has the molecular formula C20H22O7 and a molecular weight of 374.39 g/mol. Its IUPAC name is [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate.
| Compound Name | [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 2501210 |
| Molecular Formula | C20H22O7 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCC(=O)c2ccc(OC)cc2OC)cc1OC |
| InChI | InChI=1S/C20H22O7/c1-5-26-17-9-6-13(10-19(17)25-4)20(22)27-12-16(21)15-8-7-14(23-2)11-18(15)24-3/h6-11H,5,12H2,1-4H3 |
| InChIKey | LFWRICMFAGUZDQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |