C19H20O6 — CID 8023897
[2-(4-ethoxyphenyl)-2-oxoethyl] 2,4-dimethoxybenzoate (PubChem CID 8023897) has the molecular formula C19H20O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is [2-(4-ethoxyphenyl)-2-oxoethyl] 2,4-dimethoxybenzoate.
| Compound Name | [2-(4-ethoxyphenyl)-2-oxoethyl] 2,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 8023897 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | [2-(4-ethoxyphenyl)-2-oxoethyl] 2,4-dimethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)COC(=O)c2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C19H20O6/c1-4-24-14-7-5-13(6-8-14)17(20)12-25-19(21)16-10-9-15(22-2)11-18(16)23-3/h5-11H,4,12H2,1-3H3 |
| InChIKey | MAKVCABFVVPKLU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |