C21H22O6 — CID 8023796
[2-(4-ethoxyphenyl)-2-oxoethyl] (E)-3-(2,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 8023796) has the molecular formula C21H22O6 and a molecular weight of 370.40 g/mol. Its IUPAC name is [2-(4-ethoxyphenyl)-2-oxoethyl] (E)-3-(2,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(4-ethoxyphenyl)-2-oxoethyl] (E)-3-(2,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8023796 |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | [2-(4-ethoxyphenyl)-2-oxoethyl] (E)-3-(2,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccc(C(=O)COC(=O)/C=C/c2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C21H22O6/c1-4-26-17-9-5-15(6-10-17)19(22)14-27-21(23)12-8-16-7-11-18(24-2)13-20(16)25-3/h5-13H,4,14H2,1-3H3/b12-8+ |
| InChIKey | CFONMNQHZUCXIL-XYOKQWHBSA-N |
| XLogP | 3.54 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|