C19H17BrO5 — CID 7654022
[2-(3-bromophenyl)-2-oxoethyl] (E)-3-(2,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 7654022) has the molecular formula C19H17BrO5 and a molecular weight of 405.24 g/mol. Its IUPAC name is [2-(3-bromophenyl)-2-oxoethyl] (E)-3-(2,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(3-bromophenyl)-2-oxoethyl] (E)-3-(2,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7654022 |
| Molecular Formula | C19H17BrO5 |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | [2-(3-bromophenyl)-2-oxoethyl] (E)-3-(2,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)OCC(=O)c2cccc(Br)c2)c1 |
| InChI | InChI=1S/C19H17BrO5/c1-23-16-7-8-18(24-2)14(11-16)6-9-19(22)25-12-17(21)13-4-3-5-15(20)10-13/h3-11H,12H2,1-2H3/b9-6+ |
| InChIKey | YHVRDHVPGVRVSA-RMKNXTFCSA-N |
| XLogP | 3.91 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|