C19H19BrO5 — CID 7653620
2-(3-bromophenoxy)ethyl (E)-3-(2,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 7653620) has the molecular formula C19H19BrO5 and a molecular weight of 407.26 g/mol. Its IUPAC name is 2-(3-bromophenoxy)ethyl (E)-3-(2,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | 2-(3-bromophenoxy)ethyl (E)-3-(2,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7653620 |
| Molecular Formula | C19H19BrO5 |
| Molecular Weight | 407.26 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 2-(3-bromophenoxy)ethyl (E)-3-(2,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)OCCOc2cccc(Br)c2)c1 |
| InChI | InChI=1S/C19H19BrO5/c1-22-16-7-8-18(23-2)14(12-16)6-9-19(21)25-11-10-24-17-5-3-4-15(20)13-17/h3-9,12-13H,10-11H2,1-2H3/b9-6+ |
| InChIKey | MMKVTMKUMXTUDM-RMKNXTFCSA-N |
| XLogP | 4.10 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.26 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|