About 2-(3-bromophenoxy)ethyl 2-methoxybenzoate
2-(3-bromophenoxy)ethyl 2-methoxybenzoate (PubChem CID 55318537) has the molecular formula C16H15BrO4
and a molecular weight of 351.20 g/mol. Its IUPAC name is 2-(3-bromophenoxy)ethyl 2-methoxybenzoate.
Molecular Properties
| Compound Name | 2-(3-bromophenoxy)ethyl 2-methoxybenzoate |
| PubChem CID | 55318537 |
| Molecular Formula | C16H15BrO4 |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 2-(3-bromophenoxy)ethyl 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)OCCOc1cccc(Br)c1 |
| InChI | InChI=1S/C16H15BrO4/c1-19-15-8-3-2-7-14(15)16(18)21-10-9-20-13-6-4-5-12(17)11-13/h2-8,11H,9-10H2,1H3 |
| InChIKey | OUERLVAQBZXKEQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-bromophenoxy)ethyl 2-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromophenoxy)ethyl 2-methoxybenzoate?
The IUPAC name of 2-(3-bromophenoxy)ethyl 2-methoxybenzoate (CID 55318537) is 2-(3-bromophenoxy)ethyl 2-methoxybenzoate.
What is the SMILES notation for 2-(3-bromophenoxy)ethyl 2-methoxybenzoate?
The canonical SMILES for 2-(3-bromophenoxy)ethyl 2-methoxybenzoate is COc1ccccc1C(=O)OCCOc1cccc(Br)c1.
What is the InChIKey of 2-(3-bromophenoxy)ethyl 2-methoxybenzoate?
The InChIKey is OUERLVAQBZXKEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15BrO4/c1-19-15-8-3-2-7-14(15)16(18)21-10-9-20-13-6-4-5-12(17)11-13/h2-8,11H,9-10H2,1H3.
What are the key properties of 2-(3-bromophenoxy)ethyl 2-methoxybenzoate?
2-(3-bromophenoxy)ethyl 2-methoxybenzoate has a molecular weight of 351.20 g/mol, XLogP of 3.69, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromophenoxy)ethyl 2-methoxybenzoate is sourced from PubChem (CID 55318537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).