C18H20O5 — CID 46805086
2-(3,5-dimethylphenoxy)ethyl 2-hydroxy-3-methoxybenzoate (PubChem CID 46805086) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is 2-(3,5-dimethylphenoxy)ethyl 2-hydroxy-3-methoxybenzoate.
| Compound Name | 2-(3,5-dimethylphenoxy)ethyl 2-hydroxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 46805086 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 2-(3,5-dimethylphenoxy)ethyl 2-hydroxy-3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)OCCOc2cc(C)cc(C)c2)c1O |
| InChI | InChI=1S/C18H20O5/c1-12-9-13(2)11-14(10-12)22-7-8-23-18(20)15-5-4-6-16(21-3)17(15)19/h4-6,9-11,19H,7-8H2,1-3H3 |
| InChIKey | WSKIXIDAKVGBTB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|