C18H17BrO4 — CID 20991576
3-[5-bromo-2-[2-(3-methylphenoxy)ethoxy]phenyl]prop-2-enoic acid (PubChem CID 20991576) has the molecular formula C18H17BrO4 and a molecular weight of 377.23 g/mol. Its IUPAC name is 3-[5-bromo-2-[2-(3-methylphenoxy)ethoxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[5-bromo-2-[2-(3-methylphenoxy)ethoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 20991576 |
| Molecular Formula | C18H17BrO4 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 3-[5-bromo-2-[2-(3-methylphenoxy)ethoxy]phenyl]prop-2-enoic acid |
| SMILES | Cc1cccc(OCCOc2ccc(Br)cc2C=CC(=O)O)c1 |
| InChI | InChI=1S/C18H17BrO4/c1-13-3-2-4-16(11-13)22-9-10-23-17-7-6-15(19)12-14(17)5-8-18(20)21/h2-8,11-12H,9-10H2,1H3,(H,20,21) |
| InChIKey | IUGBNXLFVDPTIS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|