C14H17BrO4 — CID 77058113
3-[5-bromo-2-(3-ethoxypropoxy)phenyl]prop-2-enoic acid (PubChem CID 77058113) has the molecular formula C14H17BrO4 and a molecular weight of 329.19 g/mol. Its IUPAC name is 3-[5-bromo-2-(3-ethoxypropoxy)phenyl]prop-2-enoic acid.
| Compound Name | 3-[5-bromo-2-(3-ethoxypropoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77058113 |
| Molecular Formula | C14H17BrO4 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 3-[5-bromo-2-(3-ethoxypropoxy)phenyl]prop-2-enoic acid |
| SMILES | CCOCCCOc1ccc(Br)cc1C=CC(=O)O |
| InChI | InChI=1S/C14H17BrO4/c1-2-18-8-3-9-19-13-6-5-12(15)10-11(13)4-7-14(16)17/h4-7,10H,2-3,8-9H2,1H3,(H,16,17) |
| InChIKey | YHNMCNRFJRWCOE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|