C11H8BrF3O3 — CID 29018109
(E)-3-[5-bromo-2-(2,2,2-trifluoroethoxy)phenyl]prop-2-enoic acid (PubChem CID 29018109) has the molecular formula C11H8BrF3O3 and a molecular weight of 325.08 g/mol. Its IUPAC name is (E)-3-[5-bromo-2-(2,2,2-trifluoroethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-bromo-2-(2,2,2-trifluoroethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 29018109 |
| Molecular Formula | C11H8BrF3O3 |
| Molecular Weight | 325.08 g/mol |
| Exact Mass | 323.96 |
| IUPAC Name | (E)-3-[5-bromo-2-(2,2,2-trifluoroethoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(Br)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C11H8BrF3O3/c12-8-2-3-9(18-6-11(13,14)15)7(5-8)1-4-10(16)17/h1-5H,6H2,(H,16,17)/b4-1+ |
| InChIKey | IKXQFJQXJNGXOA-DAFODLJHSA-N |
| XLogP | 3.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.08 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|