C13H15BrO5S — CID 43807972
(E)-3-[5-bromo-2-(2-ethylsulfonylethoxy)phenyl]prop-2-enoic acid (PubChem CID 43807972) has the molecular formula C13H15BrO5S and a molecular weight of 363.23 g/mol. Its IUPAC name is (E)-3-[5-bromo-2-(2-ethylsulfonylethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-bromo-2-(2-ethylsulfonylethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 43807972 |
| Molecular Formula | C13H15BrO5S |
| Molecular Weight | 363.23 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | (E)-3-[5-bromo-2-(2-ethylsulfonylethoxy)phenyl]prop-2-enoic acid |
| SMILES | CCS(=O)(=O)CCOc1ccc(Br)cc1/C=C/C(=O)O |
| InChI | InChI=1S/C13H15BrO5S/c1-2-20(17,18)8-7-19-12-5-4-11(14)9-10(12)3-6-13(15)16/h3-6,9H,2,7-8H2,1H3,(H,15,16)/b6-3+ |
| InChIKey | XOQJRVOGVGGMPI-ZZXKWVIFSA-N |
| XLogP | 2.36 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|