C19H17BrN2O3S — CID 2896117
2-amino-5-[[5-bromo-2-[2-(3-methylphenoxy)ethoxy]phenyl]methylidene]-1,3-thiazol-4-one (PubChem CID 2896117) has the molecular formula C19H17BrN2O3S and a molecular weight of 433.33 g/mol. Its IUPAC name is 2-amino-5-[[5-bromo-2-[2-(3-methylphenoxy)ethoxy]phenyl]methylidene]-1,3-thiazol-4-one.
| Compound Name | 2-amino-5-[[5-bromo-2-[2-(3-methylphenoxy)ethoxy]phenyl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 2896117 |
| Molecular Formula | C19H17BrN2O3S |
| Molecular Weight | 433.33 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | 2-amino-5-[[5-bromo-2-[2-(3-methylphenoxy)ethoxy]phenyl]methylidene]-1,3-thiazol-4-one |
| SMILES | Cc1cccc(OCCOc2ccc(Br)cc2C=C2SC(N)=NC2=O)c1 |
| InChI | InChI=1S/C19H17BrN2O3S/c1-12-3-2-4-15(9-12)24-7-8-25-16-6-5-14(20)10-13(16)11-17-18(23)22-19(21)26-17/h2-6,9-11H,7-8H2,1H3,(H2,21,22,23) |
| InChIKey | KHQOBAWURBGZGE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|