C18H15BrN2O2S — CID 16634030
(5Z)-2-amino-5-[[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazol-4-one (PubChem CID 16634030) has the molecular formula C18H15BrN2O2S and a molecular weight of 403.30 g/mol. Its IUPAC name is (5Z)-2-amino-5-[[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazol-4-one.
| Compound Name | (5Z)-2-amino-5-[[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 16634030 |
| Molecular Formula | C18H15BrN2O2S |
| Molecular Weight | 403.30 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | (5Z)-2-amino-5-[[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazol-4-one |
| SMILES | Cc1ccc(COc2ccc(Br)cc2/C=C2\SC(N)=NC2=O)cc1 |
| InChI | InChI=1S/C18H15BrN2O2S/c1-11-2-4-12(5-3-11)10-23-15-7-6-14(19)8-13(15)9-16-17(22)21-18(20)24-16/h2-9H,10H2,1H3,(H2,20,21,22)/b16-9- |
| InChIKey | XFTDLUJUPKTOJS-SXGWCWSVSA-N |
| XLogP | 4.27 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.30 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|