C11H9BrN2O3S — CID 18529043
(5E)-2-amino-5-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]-1,3-thiazol-4-one (PubChem CID 18529043) has the molecular formula C11H9BrN2O3S and a molecular weight of 329.18 g/mol. Its IUPAC name is (5E)-2-amino-5-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]-1,3-thiazol-4-one.
| Compound Name | (5E)-2-amino-5-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 18529043 |
| Molecular Formula | C11H9BrN2O3S |
| Molecular Weight | 329.18 g/mol |
| Exact Mass | 327.95 |
| IUPAC Name | (5E)-2-amino-5-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]-1,3-thiazol-4-one |
| SMILES | COc1cc(Br)cc(/C=C2/SC(N)=NC2=O)c1O |
| InChI | InChI=1S/C11H9BrN2O3S/c1-17-7-4-6(12)2-5(9(7)15)3-8-10(16)14-11(13)18-8/h2-4,15H,1H3,(H2,13,14,16)/b8-3+ |
| InChIKey | OMODHILFDWKGLT-FPYGCLRLSA-N |
| XLogP | 2.09 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.18 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|