C11H8BrNO4S — CID 2844355
5-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 2844355) has the molecular formula C11H8BrNO4S and a molecular weight of 330.16 g/mol. Its IUPAC name is 5-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2844355 |
| Molecular Formula | C11H8BrNO4S |
| Molecular Weight | 330.16 g/mol |
| Exact Mass | 328.94 |
| IUPAC Name | 5-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(Br)cc(C=C2SC(=O)NC2=O)c1O |
| InChI | InChI=1S/C11H8BrNO4S/c1-17-7-4-6(12)2-5(9(7)14)3-8-10(15)13-11(16)18-8/h2-4,14H,1H3,(H,13,15,16) |
| InChIKey | LRQZMRHGRBHVRW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.16 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|