C18H14BrClN2O3S — CID 137155744
(5Z)-5-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]-2-(3-chloro-4-methylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137155744) has the molecular formula C18H14BrClN2O3S and a molecular weight of 453.75 g/mol. Its IUPAC name is (5Z)-5-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]-2-(3-chloro-4-methylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]-2-(3-chloro-4-methylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137155744 |
| Molecular Formula | C18H14BrClN2O3S |
| Molecular Weight | 453.75 g/mol |
| Exact Mass | 451.96 |
| IUPAC Name | (5Z)-5-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]-2-(3-chloro-4-methylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | COc1cc(Br)cc(/C=C2\S/C(=N/c3ccc(C)c(Cl)c3)NC2=O)c1O |
| InChI | InChI=1S/C18H14BrClN2O3S/c1-9-3-4-12(8-13(9)20)21-18-22-17(24)15(26-18)6-10-5-11(19)7-14(25-2)16(10)23/h3-8,23H,1-2H3,(H,21,22,24)/b15-6- |
| InChIKey | CPPDWGLBVVVZAA-UUASQNMZSA-N |
| XLogP | 5.02 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.75 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|