C18H14Br2N2O3S — CID 135431166
5-[(5-bromo-3-ethoxy-2-hydroxyphenyl)methylidene]-2-(4-bromophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135431166) has the molecular formula C18H14Br2N2O3S and a molecular weight of 498.20 g/mol. Its IUPAC name is 5-[(5-bromo-3-ethoxy-2-hydroxyphenyl)methylidene]-2-(4-bromophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(5-bromo-3-ethoxy-2-hydroxyphenyl)methylidene]-2-(4-bromophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135431166 |
| Molecular Formula | C18H14Br2N2O3S |
| Molecular Weight | 498.20 g/mol |
| Exact Mass | 495.91 |
| IUPAC Name | 5-[(5-bromo-3-ethoxy-2-hydroxyphenyl)methylidene]-2-(4-bromophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(Br)cc(C=C2S/C(=N/c3ccc(Br)cc3)NC2=O)c1O |
| InChI | InChI=1S/C18H14Br2N2O3S/c1-2-25-14-9-12(20)7-10(16(14)23)8-15-17(24)22-18(26-15)21-13-5-3-11(19)4-6-13/h3-9,23H,2H2,1H3,(H,21,22,24) |
| InChIKey | AXCHNYJXETWFDE-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.20 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|