C20H18Br2N2O3S — CID 137044185
(5Z)-5-[(3-bromo-4,5-diethoxyphenyl)methylidene]-2-(4-bromophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137044185) has the molecular formula C20H18Br2N2O3S and a molecular weight of 526.25 g/mol. Its IUPAC name is (5Z)-5-[(3-bromo-4,5-diethoxyphenyl)methylidene]-2-(4-bromophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3-bromo-4,5-diethoxyphenyl)methylidene]-2-(4-bromophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137044185 |
| Molecular Formula | C20H18Br2N2O3S |
| Molecular Weight | 526.25 g/mol |
| Exact Mass | 523.94 |
| IUPAC Name | (5Z)-5-[(3-bromo-4,5-diethoxyphenyl)methylidene]-2-(4-bromophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2\S/C(=N/c3ccc(Br)cc3)NC2=O)cc(Br)c1OCC |
| InChI | InChI=1S/C20H18Br2N2O3S/c1-3-26-16-10-12(9-15(22)18(16)27-4-2)11-17-19(25)24-20(28-17)23-14-7-5-13(21)6-8-14/h5-11H,3-4H2,1-2H3,(H,23,24,25)/b17-11- |
| InChIKey | OPFDNBDRVDMELI-BOPFTXTBSA-N |
| XLogP | 5.90 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.25 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|