C19H16ClN3O5S — CID 135438949
(5Z)-2-(3-chloro-4-methylphenyl)imino-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 135438949) has the molecular formula C19H16ClN3O5S and a molecular weight of 433.87 g/mol. Its IUPAC name is (5Z)-2-(3-chloro-4-methylphenyl)imino-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(3-chloro-4-methylphenyl)imino-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135438949 |
| Molecular Formula | C19H16ClN3O5S |
| Molecular Weight | 433.87 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | (5Z)-2-(3-chloro-4-methylphenyl)imino-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=C2\S/C(=N/c3ccc(C)c(Cl)c3)NC2=O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C19H16ClN3O5S/c1-10-4-5-12(8-13(10)20)21-19-22-18(24)17(29-19)7-11-6-15(27-2)16(28-3)9-14(11)23(25)26/h4-9H,1-3H3,(H,21,22,24)/b17-7- |
| InChIKey | GJZHVYXXDYXZKP-IDUWFGFVSA-N |
| XLogP | 4.47 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.87 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|