C20H18BrN3O5S — CID 137044113
(5Z)-2-(4-bromo-3,5-dimethylphenyl)imino-5-[(2,4-dimethoxy-5-nitrophenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 137044113) has the molecular formula C20H18BrN3O5S and a molecular weight of 492.35 g/mol. Its IUPAC name is (5Z)-2-(4-bromo-3,5-dimethylphenyl)imino-5-[(2,4-dimethoxy-5-nitrophenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-bromo-3,5-dimethylphenyl)imino-5-[(2,4-dimethoxy-5-nitrophenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137044113 |
| Molecular Formula | C20H18BrN3O5S |
| Molecular Weight | 492.35 g/mol |
| Exact Mass | 491.02 |
| IUPAC Name | (5Z)-2-(4-bromo-3,5-dimethylphenyl)imino-5-[(2,4-dimethoxy-5-nitrophenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1cc(OC)c([N+](=O)[O-])cc1/C=C1\S/C(=N/c2cc(C)c(Br)c(C)c2)NC1=O |
| InChI | InChI=1S/C20H18BrN3O5S/c1-10-5-13(6-11(2)18(10)21)22-20-23-19(25)17(30-20)8-12-7-14(24(26)27)16(29-4)9-15(12)28-3/h5-9H,1-4H3,(H,22,23,25)/b17-8- |
| InChIKey | MBDNAWFMDLFFJU-IUXPMGMMSA-N |
| XLogP | 4.88 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.35 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|