C22H18BrN3O5S — CID 137071702
(5Z)-5-[(5-bromo-3-methoxy-2-prop-2-ynoxyphenyl)methylidene]-2-(3,4-dimethyl-5-nitrophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137071702) has the molecular formula C22H18BrN3O5S and a molecular weight of 516.37 g/mol. Its IUPAC name is (5Z)-5-[(5-bromo-3-methoxy-2-prop-2-ynoxyphenyl)methylidene]-2-(3,4-dimethyl-5-nitrophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(5-bromo-3-methoxy-2-prop-2-ynoxyphenyl)methylidene]-2-(3,4-dimethyl-5-nitrophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137071702 |
| Molecular Formula | C22H18BrN3O5S |
| Molecular Weight | 516.37 g/mol |
| Exact Mass | 515.02 |
| IUPAC Name | (5Z)-5-[(5-bromo-3-methoxy-2-prop-2-ynoxyphenyl)methylidene]-2-(3,4-dimethyl-5-nitrophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | C#CCOc1c(/C=C2\S/C(=N/c3cc(C)c(C)c([N+](=O)[O-])c3)NC2=O)cc(Br)cc1OC |
| InChI | InChI=1S/C22H18BrN3O5S/c1-5-6-31-20-14(8-15(23)10-18(20)30-4)9-19-21(27)25-22(32-19)24-16-7-12(2)13(3)17(11-16)26(28)29/h1,7-11H,6H2,2-4H3,(H,24,25,27)/b19-9- |
| InChIKey | UEZOKVJGYPQBFU-OCKHKDLRSA-N |
| XLogP | 4.89 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.37 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|