C22H19BrN2O3S — CID 135781826
(5E)-5-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-2-(2,3-dimethylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135781826) has the molecular formula C22H19BrN2O3S and a molecular weight of 471.38 g/mol. Its IUPAC name is (5E)-5-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-2-(2,3-dimethylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-2-(2,3-dimethylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135781826 |
| Molecular Formula | C22H19BrN2O3S |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 470.03 |
| IUPAC Name | (5E)-5-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-2-(2,3-dimethylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | C#CCOc1c(Br)cc(/C=C2/S/C(=N\c3cccc(C)c3C)NC2=O)cc1OC |
| InChI | InChI=1S/C22H19BrN2O3S/c1-5-9-28-20-16(23)10-15(11-18(20)27-4)12-19-21(26)25-22(29-19)24-17-8-6-7-13(2)14(17)3/h1,6-8,10-12H,9H2,2-4H3,(H,24,25,26)/b19-12+ |
| InChIKey | PSCKDKPCPJFAFK-XDHOZWIPSA-N |
| XLogP | 4.98 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|