C21H16BrClN2O3S — CID 135418610
(5Z)-5-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-2-(3-chloro-4-methylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135418610) has the molecular formula C21H16BrClN2O3S and a molecular weight of 491.79 g/mol. Its IUPAC name is (5Z)-5-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-2-(3-chloro-4-methylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-2-(3-chloro-4-methylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135418610 |
| Molecular Formula | C21H16BrClN2O3S |
| Molecular Weight | 491.79 g/mol |
| Exact Mass | 489.98 |
| IUPAC Name | (5Z)-5-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-2-(3-chloro-4-methylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | C#CCOc1c(Br)cc(/C=C2\S/C(=N/c3ccc(C)c(Cl)c3)NC2=O)cc1OC |
| InChI | InChI=1S/C21H16BrClN2O3S/c1-4-7-28-19-15(22)8-13(9-17(19)27-3)10-18-20(26)25-21(29-18)24-14-6-5-12(2)16(23)11-14/h1,5-6,8-11H,7H2,2-3H3,(H,24,25,26)/b18-10- |
| InChIKey | OIXFPLSCFAWVQE-ZDLGFXPLSA-N |
| XLogP | 5.32 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.79 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|