C19H16Br2N2O2S — CID 135451319
(5Z)-5-[(3,5-dibromo-4-methoxyphenyl)methylidene]-2-(3,4-dimethylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135451319) has the molecular formula C19H16Br2N2O2S and a molecular weight of 496.22 g/mol. Its IUPAC name is (5Z)-5-[(3,5-dibromo-4-methoxyphenyl)methylidene]-2-(3,4-dimethylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3,5-dibromo-4-methoxyphenyl)methylidene]-2-(3,4-dimethylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135451319 |
| Molecular Formula | C19H16Br2N2O2S |
| Molecular Weight | 496.22 g/mol |
| Exact Mass | 493.93 |
| IUPAC Name | (5Z)-5-[(3,5-dibromo-4-methoxyphenyl)methylidene]-2-(3,4-dimethylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | COc1c(Br)cc(/C=C2\S/C(=N/c3ccc(C)c(C)c3)NC2=O)cc1Br |
| InChI | InChI=1S/C19H16Br2N2O2S/c1-10-4-5-13(6-11(10)2)22-19-23-18(24)16(26-19)9-12-7-14(20)17(25-3)15(21)8-12/h4-9H,1-3H3,(H,22,23,24)/b16-9- |
| InChIKey | SILFPWSSCHSCBQ-SXGWCWSVSA-N |
| XLogP | 5.73 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.22 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|