C18H15BrN2O3S — CID 137075122
(5Z)-5-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 137075122) has the molecular formula C18H15BrN2O3S and a molecular weight of 419.30 g/mol. Its IUPAC name is (5Z)-5-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137075122 |
| Molecular Formula | C18H15BrN2O3S |
| Molecular Weight | 419.30 g/mol |
| Exact Mass | 418.00 |
| IUPAC Name | (5Z)-5-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=C2\S/C(=N/c3ccccc3)NC2=O)cc(Br)c1OC |
| InChI | InChI=1S/C18H15BrN2O3S/c1-23-14-9-11(8-13(19)16(14)24-2)10-15-17(22)21-18(25-15)20-12-6-4-3-5-7-12/h3-10H,1-2H3,(H,20,21,22)/b15-10- |
| InChIKey | WODIXSNSWKGDAT-GDNBJRDFSA-N |
| XLogP | 4.36 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.30 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|