C25H19BrN2O5S — CID 137069550
[2-bromo-6-methoxy-4-[(Z)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] benzoate (PubChem CID 137069550) has the molecular formula C25H19BrN2O5S and a molecular weight of 539.41 g/mol. Its IUPAC name is [2-bromo-6-methoxy-4-[(Z)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] benzoate.
| Compound Name | [2-bromo-6-methoxy-4-[(Z)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 137069550 |
| Molecular Formula | C25H19BrN2O5S |
| Molecular Weight | 539.41 g/mol |
| Exact Mass | 538.02 |
| IUPAC Name | [2-bromo-6-methoxy-4-[(Z)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] benzoate |
| SMILES | COc1ccc(/N=C2\NC(=O)/C(=C/c3cc(Br)c(OC(=O)c4ccccc4)c(OC)c3)S2)cc1 |
| InChI | InChI=1S/C25H19BrN2O5S/c1-31-18-10-8-17(9-11-18)27-25-28-23(29)21(34-25)14-15-12-19(26)22(20(13-15)32-2)33-24(30)16-6-4-3-5-7-16/h3-14H,1-2H3,(H,27,28,29)/b21-14- |
| InChIKey | LKMFBLBWIUUEFU-STZFKDTASA-N |
| XLogP | 5.58 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.41 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|