C18H13BrN2O4S — CID 137130856
N-[(5Z)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide (PubChem CID 137130856) has the molecular formula C18H13BrN2O4S and a molecular weight of 433.28 g/mol. Its IUPAC name is N-[(5Z)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide.
| Compound Name | N-[(5Z)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide |
|---|---|
| PubChem CID | 137130856 |
| Molecular Formula | C18H13BrN2O4S |
| Molecular Weight | 433.28 g/mol |
| Exact Mass | 431.98 |
| IUPAC Name | N-[(5Z)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide |
| SMILES | COc1cc(/C=C2\S/C(=N/C(=O)c3ccccc3)NC2=O)cc(Br)c1O |
| InChI | InChI=1S/C18H13BrN2O4S/c1-25-13-8-10(7-12(19)15(13)22)9-14-17(24)21-18(26-14)20-16(23)11-5-3-2-4-6-11/h2-9,22H,1H3,(H,20,21,23,24)/b14-9- |
| InChIKey | DKCZCLXNENHMND-ZROIWOOFSA-N |
| XLogP | 3.56 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|