C25H18BrFN2O4S — CID 137124589
N-[(5Z)-5-[[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide (PubChem CID 137124589) has the molecular formula C25H18BrFN2O4S and a molecular weight of 541.40 g/mol. Its IUPAC name is N-[(5Z)-5-[[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide.
| Compound Name | N-[(5Z)-5-[[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide |
|---|---|
| PubChem CID | 137124589 |
| Molecular Formula | C25H18BrFN2O4S |
| Molecular Weight | 541.40 g/mol |
| Exact Mass | 540.02 |
| IUPAC Name | N-[(5Z)-5-[[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide |
| SMILES | COc1cc(/C=C2\S/C(=N/C(=O)c3ccccc3)NC2=O)cc(Br)c1OCc1ccccc1F |
| InChI | InChI=1S/C25H18BrFN2O4S/c1-32-20-12-15(11-18(26)22(20)33-14-17-9-5-6-10-19(17)27)13-21-24(31)29-25(34-21)28-23(30)16-7-3-2-4-8-16/h2-13H,14H2,1H3,(H,28,29,30,31)/b21-13- |
| InChIKey | GNBZTFLVYVDYBR-BKUYFWCQSA-N |
| XLogP | 5.58 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.40 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|