C26H19Cl2FN2O4S — CID 137131004
4-chloro-N-[(5Z)-5-[[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide (PubChem CID 137131004) has the molecular formula C26H19Cl2FN2O4S and a molecular weight of 545.42 g/mol. Its IUPAC name is 4-chloro-N-[(5Z)-5-[[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide.
| Compound Name | 4-chloro-N-[(5Z)-5-[[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide |
|---|---|
| PubChem CID | 137131004 |
| Molecular Formula | C26H19Cl2FN2O4S |
| Molecular Weight | 545.42 g/mol |
| Exact Mass | 544.04 |
| IUPAC Name | 4-chloro-N-[(5Z)-5-[[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide |
| SMILES | CCOc1cc(/C=C2\S/C(=N/C(=O)c3ccc(Cl)cc3)NC2=O)cc(Cl)c1OCc1ccccc1F |
| InChI | InChI=1S/C26H19Cl2FN2O4S/c1-2-34-21-12-15(11-19(28)23(21)35-14-17-5-3-4-6-20(17)29)13-22-25(33)31-26(36-22)30-24(32)16-7-9-18(27)10-8-16/h3-13H,2,14H2,1H3,(H,30,31,32,33)/b22-13- |
| InChIKey | KMKMBPGYSGDBDO-XKZIYDEJSA-N |
| XLogP | 6.51 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.42 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|