C26H22ClFN2O4S — CID 135478627
5-[[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135478627) has the molecular formula C26H22ClFN2O4S and a molecular weight of 512.99 g/mol. Its IUPAC name is 5-[[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135478627 |
| Molecular Formula | C26H22ClFN2O4S |
| Molecular Weight | 512.99 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | 5-[[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(C=C2S/C(=N/c3ccc(OC)cc3)NC2=O)cc(Cl)c1OCc1ccccc1F |
| InChI | InChI=1S/C26H22ClFN2O4S/c1-3-33-22-13-16(12-20(27)24(22)34-15-17-6-4-5-7-21(17)28)14-23-25(31)30-26(35-23)29-18-8-10-19(32-2)11-9-18/h4-14H,3,15H2,1-2H3,(H,29,30,31) |
| InChIKey | STEJLLGTBVGPIV-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.99 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|