C19H15ClN2O4S — CID 137124440
N-[(5Z)-5-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide (PubChem CID 137124440) has the molecular formula C19H15ClN2O4S and a molecular weight of 402.86 g/mol. Its IUPAC name is N-[(5Z)-5-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide.
| Compound Name | N-[(5Z)-5-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide |
|---|---|
| PubChem CID | 137124440 |
| Molecular Formula | C19H15ClN2O4S |
| Molecular Weight | 402.86 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | N-[(5Z)-5-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide |
| SMILES | CCOc1cc(/C=C2\S/C(=N/C(=O)c3ccccc3)NC2=O)cc(Cl)c1O |
| InChI | InChI=1S/C19H15ClN2O4S/c1-2-26-14-9-11(8-13(20)16(14)23)10-15-18(25)22-19(27-15)21-17(24)12-6-4-3-5-7-12/h3-10,23H,2H2,1H3,(H,21,22,24,25)/b15-10- |
| InChIKey | YWFYJLHIRHUQSQ-GDNBJRDFSA-N |
| XLogP | 3.84 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.86 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|