C18H13N3O6S — CID 137130821
N-[(5Z)-5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide (PubChem CID 137130821) has the molecular formula C18H13N3O6S and a molecular weight of 399.38 g/mol. Its IUPAC name is N-[(5Z)-5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide.
| Compound Name | N-[(5Z)-5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide |
|---|---|
| PubChem CID | 137130821 |
| Molecular Formula | C18H13N3O6S |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | N-[(5Z)-5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide |
| SMILES | COc1cc(/C=C2\S/C(=N/C(=O)c3ccccc3)NC2=O)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C18H13N3O6S/c1-27-13-8-10(7-12(15(13)22)21(25)26)9-14-17(24)20-18(28-14)19-16(23)11-5-3-2-4-6-11/h2-9,22H,1H3,(H,19,20,23,24)/b14-9- |
| InChIKey | GGKKJPQNIDCPOO-ZROIWOOFSA-N |
| XLogP | 2.71 |
| TPSA | 131.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|