C27H21N3O4S — CID 137131131
N-[(5Z)-5-[[4-[(2-cyanophenyl)methoxy]-3-ethoxyphenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide (PubChem CID 137131131) has the molecular formula C27H21N3O4S and a molecular weight of 483.55 g/mol. Its IUPAC name is N-[(5Z)-5-[[4-[(2-cyanophenyl)methoxy]-3-ethoxyphenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide.
| Compound Name | N-[(5Z)-5-[[4-[(2-cyanophenyl)methoxy]-3-ethoxyphenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide |
|---|---|
| PubChem CID | 137131131 |
| Molecular Formula | C27H21N3O4S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | N-[(5Z)-5-[[4-[(2-cyanophenyl)methoxy]-3-ethoxyphenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide |
| SMILES | CCOc1cc(/C=C2\S/C(=N/C(=O)c3ccccc3)NC2=O)ccc1OCc1ccccc1C#N |
| InChI | InChI=1S/C27H21N3O4S/c1-2-33-23-14-18(12-13-22(23)34-17-21-11-7-6-10-20(21)16-28)15-24-26(32)30-27(35-24)29-25(31)19-8-4-3-5-9-19/h3-15H,2,17H2,1H3,(H,29,30,31,32)/b24-15- |
| InChIKey | XVZMGBHVDPVSTB-IWIPYMOSSA-N |
| XLogP | 4.94 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|