C25H15BrClN3O3S — CID 137124662
N-[(5Z)-5-[[5-bromo-2-[(2-cyanophenyl)methoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-4-chlorobenzamide (PubChem CID 137124662) has the molecular formula C25H15BrClN3O3S and a molecular weight of 552.84 g/mol. Its IUPAC name is N-[(5Z)-5-[[5-bromo-2-[(2-cyanophenyl)methoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-4-chlorobenzamide.
| Compound Name | N-[(5Z)-5-[[5-bromo-2-[(2-cyanophenyl)methoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-4-chlorobenzamide |
|---|---|
| PubChem CID | 137124662 |
| Molecular Formula | C25H15BrClN3O3S |
| Molecular Weight | 552.84 g/mol |
| Exact Mass | 550.97 |
| IUPAC Name | N-[(5Z)-5-[[5-bromo-2-[(2-cyanophenyl)methoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-4-chlorobenzamide |
| SMILES | N#Cc1ccccc1COc1ccc(Br)cc1/C=C1\S/C(=N/C(=O)c2ccc(Cl)cc2)NC1=O |
| InChI | InChI=1S/C25H15BrClN3O3S/c26-19-7-10-21(33-14-17-4-2-1-3-16(17)13-28)18(11-19)12-22-24(32)30-25(34-22)29-23(31)15-5-8-20(27)9-6-15/h1-12H,14H2,(H,29,30,31,32)/b22-12- |
| InChIKey | LEXDLPSYJIIPSX-UUYOSTAYSA-N |
| XLogP | 5.95 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.84 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|