C24H15BrClN3O5S — CID 137130664
N-[(5Z)-5-[[5-bromo-2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-4-chlorobenzamide (PubChem CID 137130664) has the molecular formula C24H15BrClN3O5S and a molecular weight of 572.82 g/mol. Its IUPAC name is N-[(5Z)-5-[[5-bromo-2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-4-chlorobenzamide.
| Compound Name | N-[(5Z)-5-[[5-bromo-2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-4-chlorobenzamide |
|---|---|
| PubChem CID | 137130664 |
| Molecular Formula | C24H15BrClN3O5S |
| Molecular Weight | 572.82 g/mol |
| Exact Mass | 570.96 |
| IUPAC Name | N-[(5Z)-5-[[5-bromo-2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]-4-chlorobenzamide |
| SMILES | O=C1N/C(=N\C(=O)c2ccc(Cl)cc2)S/C1=C\c1cc(Br)ccc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H15BrClN3O5S/c25-17-5-10-20(34-13-14-1-8-19(9-2-14)29(32)33)16(11-17)12-21-23(31)28-24(35-21)27-22(30)15-3-6-18(26)7-4-15/h1-12H,13H2,(H,27,28,30,31)/b21-12- |
| InChIKey | IJCLSZQDQIXSKV-MTJSOVHGSA-N |
| XLogP | 5.99 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.82 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|