C16H10BrN3O7S2 — CID 136906122
[4-bromo-2-[(Z)-[(2Z)-2-hydroxyimino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-nitrobenzenesulfonate (PubChem CID 136906122) has the molecular formula C16H10BrN3O7S2 and a molecular weight of 500.31 g/mol. Its IUPAC name is [4-bromo-2-[(Z)-[(2Z)-2-hydroxyimino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-nitrobenzenesulfonate.
| Compound Name | [4-bromo-2-[(Z)-[(2Z)-2-hydroxyimino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 136906122 |
| Molecular Formula | C16H10BrN3O7S2 |
| Molecular Weight | 500.31 g/mol |
| Exact Mass | 498.91 |
| IUPAC Name | [4-bromo-2-[(Z)-[(2Z)-2-hydroxyimino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-nitrobenzenesulfonate |
| SMILES | O=C1N/C(=N/O)S/C1=C\c1cc(Br)ccc1OS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H10BrN3O7S2/c17-10-1-6-13(9(7-10)8-14-15(21)18-16(19-22)28-14)27-29(25,26)12-4-2-11(3-5-12)20(23)24/h1-8,22H,(H,18,19,21)/b14-8- |
| InChIKey | ANSSCKMCVROVJJ-ZSOIEALJSA-N |
| XLogP | 3.07 |
| TPSA | 148.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|