C18H14N2O7S3 — CID 2267912
[2-ethoxy-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-nitrobenzenesulfonate (PubChem CID 2267912) has the molecular formula C18H14N2O7S3 and a molecular weight of 466.52 g/mol. Its IUPAC name is [2-ethoxy-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-nitrobenzenesulfonate.
| Compound Name | [2-ethoxy-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 2267912 |
| Molecular Formula | C18H14N2O7S3 |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.00 |
| IUPAC Name | [2-ethoxy-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-nitrobenzenesulfonate |
| SMILES | CCOc1cc(/C=C2\SC(=S)NC2=O)ccc1OS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H14N2O7S3/c1-2-26-15-9-11(10-16-17(21)19-18(28)29-16)3-8-14(15)27-30(24,25)13-6-4-12(5-7-13)20(22)23/h3-10H,2H2,1H3,(H,19,21,28)/b16-10- |
| InChIKey | BSEDSVYFBBWAAM-YBEGLDIGSA-N |
| XLogP | 3.25 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|