C16H17NO5S2 — CID 16634091
ethyl 2-[2-ethoxy-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate (PubChem CID 16634091) has the molecular formula C16H17NO5S2 and a molecular weight of 367.45 g/mol. Its IUPAC name is ethyl 2-[2-ethoxy-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-ethoxy-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 16634091 |
| Molecular Formula | C16H17NO5S2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | ethyl 2-[2-ethoxy-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(/C=C2\SC(=S)NC2=O)cc1OCC |
| InChI | InChI=1S/C16H17NO5S2/c1-3-20-12-7-10(8-13-15(19)17-16(23)24-13)5-6-11(12)22-9-14(18)21-4-2/h5-8H,3-4,9H2,1-2H3,(H,17,19,23)/b13-8- |
| InChIKey | KZPCQIYVYSJUBS-JYRVWZFOSA-N |
| XLogP | 2.52 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|