C20H18N2O5S2 — CID 16634090
2-[2-ethoxy-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(4-hydroxyphenyl)acetamide (PubChem CID 16634090) has the molecular formula C20H18N2O5S2 and a molecular weight of 430.51 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(4-hydroxyphenyl)acetamide.
| Compound Name | 2-[2-ethoxy-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 16634090 |
| Molecular Formula | C20H18N2O5S2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 2-[2-ethoxy-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(4-hydroxyphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2\SC(=S)NC2=O)ccc1OCC(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C20H18N2O5S2/c1-2-26-16-9-12(10-17-19(25)22-20(28)29-17)3-8-15(16)27-11-18(24)21-13-4-6-14(23)7-5-13/h3-10,23H,2,11H2,1H3,(H,21,24)(H,22,25,28)/b17-10- |
| InChIKey | OXYMAPRQLVVBMF-YVLHZVERSA-N |
| XLogP | 3.30 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|