C14H12BrNO4S2 — CID 2859512
ethyl 2-[4-bromo-2-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate (PubChem CID 2859512) has the molecular formula C14H12BrNO4S2 and a molecular weight of 402.29 g/mol. Its IUPAC name is ethyl 2-[4-bromo-2-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-bromo-2-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 2859512 |
| Molecular Formula | C14H12BrNO4S2 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 400.94 |
| IUPAC Name | ethyl 2-[4-bromo-2-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(Br)cc1C=C1SC(=S)NC1=O |
| InChI | InChI=1S/C14H12BrNO4S2/c1-2-19-12(17)7-20-10-4-3-9(15)5-8(10)6-11-13(18)16-14(21)22-11/h3-6H,2,7H2,1H3,(H,16,18,21) |
| InChIKey | HSMAABDBEIGFFL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|