C15H14BrF3N2O4S2 — CID 162334217
(5Z)-5-[[5-bromo-2-[2-(methylamino)ethoxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;2,2,2-trifluoroacetic acid (PubChem CID 162334217) has the molecular formula C15H14BrF3N2O4S2 and a molecular weight of 487.32 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-2-[2-(methylamino)ethoxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;2,2,2-trifluoroacetic acid.
| Compound Name | (5Z)-5-[[5-bromo-2-[2-(methylamino)ethoxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 162334217 |
| Molecular Formula | C15H14BrF3N2O4S2 |
| Molecular Weight | 487.32 g/mol |
| Exact Mass | 485.95 |
| IUPAC Name | (5Z)-5-[[5-bromo-2-[2-(methylamino)ethoxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;2,2,2-trifluoroacetic acid |
| SMILES | CNCCOc1ccc(Br)cc1/C=C1\SC(=S)NC1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H13BrN2O2S2.C2HF3O2/c1-15-4-5-18-10-3-2-9(14)6-8(10)7-11-12(17)16-13(19)20-11;3-2(4,5)1(6)7/h2-3,6-7,15H,4-5H2,1H3,(H,16,17,19);(H,6,7)/b11-7-; |
| InChIKey | CLICRBOOKQXXEU-AJULUCINSA-N |
| XLogP | 3.17 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|