C17H12ClNO5S3 — CID 2178097
[2-methoxy-5-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 2178097) has the molecular formula C17H12ClNO5S3 and a molecular weight of 441.94 g/mol. Its IUPAC name is [2-methoxy-5-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-methoxy-5-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 2178097 |
| Molecular Formula | C17H12ClNO5S3 |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 440.96 |
| IUPAC Name | [2-methoxy-5-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | COc1ccc(/C=C2\SC(=S)NC2=O)cc1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H12ClNO5S3/c1-23-13-7-2-10(9-15-16(20)19-17(25)26-15)8-14(13)24-27(21,22)12-5-3-11(18)4-6-12/h2-9H,1H3,(H,19,20,25)/b15-9- |
| InChIKey | XOMSLXCPMVIGKY-DHDCSXOGSA-N |
| XLogP | 3.61 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|