C25H21ClN2O5S2 — CID 137070281
[2-ethoxy-4-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 137070281) has the molecular formula C25H21ClN2O5S2 and a molecular weight of 529.04 g/mol. Its IUPAC name is [2-ethoxy-4-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-ethoxy-4-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 137070281 |
| Molecular Formula | C25H21ClN2O5S2 |
| Molecular Weight | 529.04 g/mol |
| Exact Mass | 528.06 |
| IUPAC Name | [2-ethoxy-4-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | CCOc1cc(/C=C2\S/C(=N/c3ccc(C)cc3)NC2=O)ccc1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H21ClN2O5S2/c1-3-32-22-14-17(6-13-21(22)33-35(30,31)20-11-7-18(26)8-12-20)15-23-24(29)28-25(34-23)27-19-9-4-16(2)5-10-19/h4-15H,3H2,1-2H3,(H,27,28,29)/b23-15- |
| InChIKey | YEXULJHZTBAXTI-HAHDFKILSA-N |
| XLogP | 5.71 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.04 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|