C24H18BrN3O4S — CID 137019984
(5E)-5-[(5-bromo-2-phenylmethoxyphenyl)methylidene]-2-(2-methyl-4-nitrophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137019984) has the molecular formula C24H18BrN3O4S and a molecular weight of 524.40 g/mol. Its IUPAC name is (5E)-5-[(5-bromo-2-phenylmethoxyphenyl)methylidene]-2-(2-methyl-4-nitrophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(5-bromo-2-phenylmethoxyphenyl)methylidene]-2-(2-methyl-4-nitrophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137019984 |
| Molecular Formula | C24H18BrN3O4S |
| Molecular Weight | 524.40 g/mol |
| Exact Mass | 523.02 |
| IUPAC Name | (5E)-5-[(5-bromo-2-phenylmethoxyphenyl)methylidene]-2-(2-methyl-4-nitrophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1cc([N+](=O)[O-])ccc1/N=C1/NC(=O)/C(=C\c2cc(Br)ccc2OCc2ccccc2)S1 |
| InChI | InChI=1S/C24H18BrN3O4S/c1-15-11-19(28(30)31)8-9-20(15)26-24-27-23(29)22(33-24)13-17-12-18(25)7-10-21(17)32-14-16-5-3-2-4-6-16/h2-13H,14H2,1H3,(H,26,27,29)/b22-13+ |
| InChIKey | SMDQTXJMOGHZDQ-LPYMAVHISA-N |
| XLogP | 6.14 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.40 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|