C24H17BrClN3O5S — CID 137063764
(5E)-5-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-2-(2-chloro-4-nitrophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137063764) has the molecular formula C24H17BrClN3O5S and a molecular weight of 574.84 g/mol. Its IUPAC name is (5E)-5-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-2-(2-chloro-4-nitrophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-2-(2-chloro-4-nitrophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137063764 |
| Molecular Formula | C24H17BrClN3O5S |
| Molecular Weight | 574.84 g/mol |
| Exact Mass | 572.98 |
| IUPAC Name | (5E)-5-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-2-(2-chloro-4-nitrophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=C2/S/C(=N\c3ccc([N+](=O)[O-])cc3Cl)NC2=O)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C24H17BrClN3O5S/c1-33-20-10-15(9-17(25)22(20)34-13-14-5-3-2-4-6-14)11-21-23(30)28-24(35-21)27-19-8-7-16(29(31)32)12-18(19)26/h2-12H,13H2,1H3,(H,27,28,30)/b21-11+ |
| InChIKey | KXUJSERHMJSMKW-SRZZPIQSSA-N |
| XLogP | 6.49 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.84 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|