C18H10Br3N3O6S — CID 137063187
2-[2,6-dibromo-4-[(E)-[2-(2-bromo-4-nitrophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 137063187) has the molecular formula C18H10Br3N3O6S and a molecular weight of 636.07 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-[(E)-[2-(2-bromo-4-nitrophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-dibromo-4-[(E)-[2-(2-bromo-4-nitrophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 137063187 |
| Molecular Formula | C18H10Br3N3O6S |
| Molecular Weight | 636.07 g/mol |
| Exact Mass | 632.78 |
| IUPAC Name | 2-[2,6-dibromo-4-[(E)-[2-(2-bromo-4-nitrophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1c(Br)cc(/C=C2/S/C(=N\c3ccc([N+](=O)[O-])cc3Br)NC2=O)cc1Br |
| InChI | InChI=1S/C18H10Br3N3O6S/c19-10-6-9(24(28)29)1-2-13(10)22-18-23-17(27)14(31-18)5-8-3-11(20)16(12(21)4-8)30-7-15(25)26/h1-6H,7H2,(H,25,26)(H,22,23,27)/b14-5+ |
| InChIKey | SFKWKAVSELLOLQ-LHHJGKSTSA-N |
| XLogP | 5.24 |
| TPSA | 131.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.07 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|