C18H13ClIN3O5S — CID 137020059
(5E)-2-(2-chloro-4-nitrophenyl)imino-5-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 137020059) has the molecular formula C18H13ClIN3O5S and a molecular weight of 545.74 g/mol. Its IUPAC name is (5E)-2-(2-chloro-4-nitrophenyl)imino-5-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(2-chloro-4-nitrophenyl)imino-5-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137020059 |
| Molecular Formula | C18H13ClIN3O5S |
| Molecular Weight | 545.74 g/mol |
| Exact Mass | 544.93 |
| IUPAC Name | (5E)-2-(2-chloro-4-nitrophenyl)imino-5-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2/S/C(=N\c3ccc([N+](=O)[O-])cc3Cl)NC2=O)cc(I)c1O |
| InChI | InChI=1S/C18H13ClIN3O5S/c1-2-28-14-6-9(5-12(20)16(14)24)7-15-17(25)22-18(29-15)21-13-4-3-10(23(26)27)8-11(13)19/h3-8,24H,2H2,1H3,(H,21,22,25)/b15-7+ |
| InChIKey | UHXJBLMRTKYRMI-VIZOYTHASA-N |
| XLogP | 4.85 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.74 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|