C17H11BrClN3O4S — CID 137019986
(5E)-5-[(5-bromo-2-methoxyphenyl)methylidene]-2-(4-chloro-2-nitrophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137019986) has the molecular formula C17H11BrClN3O4S and a molecular weight of 468.72 g/mol. Its IUPAC name is (5E)-5-[(5-bromo-2-methoxyphenyl)methylidene]-2-(4-chloro-2-nitrophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(5-bromo-2-methoxyphenyl)methylidene]-2-(4-chloro-2-nitrophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137019986 |
| Molecular Formula | C17H11BrClN3O4S |
| Molecular Weight | 468.72 g/mol |
| Exact Mass | 466.93 |
| IUPAC Name | (5E)-5-[(5-bromo-2-methoxyphenyl)methylidene]-2-(4-chloro-2-nitrophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(Br)cc1/C=C1/S/C(=N\c2ccc(Cl)cc2[N+](=O)[O-])NC1=O |
| InChI | InChI=1S/C17H11BrClN3O4S/c1-26-14-5-2-10(18)6-9(14)7-15-16(23)21-17(27-15)20-12-4-3-11(19)8-13(12)22(24)25/h2-8H,1H3,(H,20,21,23)/b15-7+ |
| InChIKey | SPWLTJYYJXFSIS-VIZOYTHASA-N |
| XLogP | 4.91 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.72 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|