C16H10ClN3O3S — CID 137063937
(5E)-5-benzylidene-2-(4-chloro-2-nitrophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137063937) has the molecular formula C16H10ClN3O3S and a molecular weight of 359.79 g/mol. Its IUPAC name is (5E)-5-benzylidene-2-(4-chloro-2-nitrophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-benzylidene-2-(4-chloro-2-nitrophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137063937 |
| Molecular Formula | C16H10ClN3O3S |
| Molecular Weight | 359.79 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | (5E)-5-benzylidene-2-(4-chloro-2-nitrophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\c2ccc(Cl)cc2[N+](=O)[O-])S/C1=C/c1ccccc1 |
| InChI | InChI=1S/C16H10ClN3O3S/c17-11-6-7-12(13(9-11)20(22)23)18-16-19-15(21)14(24-16)8-10-4-2-1-3-5-10/h1-9H,(H,18,19,21)/b14-8+ |
| InChIKey | PTUWJVHHEYIOBH-RIYZIHGNSA-N |
| XLogP | 4.14 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.79 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|