C24H13Br2Cl3N2O3S — CID 137124324
4-chloro-N-[(5Z)-5-[[3,5-dibromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide (PubChem CID 137124324) has the molecular formula C24H13Br2Cl3N2O3S and a molecular weight of 675.61 g/mol. Its IUPAC name is 4-chloro-N-[(5Z)-5-[[3,5-dibromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide.
| Compound Name | 4-chloro-N-[(5Z)-5-[[3,5-dibromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide |
|---|---|
| PubChem CID | 137124324 |
| Molecular Formula | C24H13Br2Cl3N2O3S |
| Molecular Weight | 675.61 g/mol |
| Exact Mass | 671.81 |
| IUPAC Name | 4-chloro-N-[(5Z)-5-[[3,5-dibromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide |
| SMILES | O=C1N/C(=N\C(=O)c2ccc(Cl)cc2)S/C1=C\c1cc(Br)c(OCc2ccc(Cl)c(Cl)c2)c(Br)c1 |
| InChI | InChI=1S/C24H13Br2Cl3N2O3S/c25-16-7-13(8-17(26)21(16)34-11-12-1-6-18(28)19(29)9-12)10-20-23(33)31-24(35-20)30-22(32)14-2-4-15(27)5-3-14/h1-10H,11H2,(H,30,31,32,33)/b20-10- |
| InChIKey | RVGPHOKTVGFADK-JMIUGGIZSA-N |
| XLogP | 8.15 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.61 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|